About propyl 5-amino-2-oxopentanoate;hydrochloride
propyl 5-amino-2-oxopentanoate;hydrochloride (PubChem CID 140983653) has the molecular formula C8H16ClNO3
and a molecular weight of 209.67 g/mol. Its IUPAC name is propyl 5-amino-2-oxopentanoate;hydrochloride.
Molecular Properties
| Compound Name | propyl 5-amino-2-oxopentanoate;hydrochloride |
| PubChem CID | 140983653 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | propyl 5-amino-2-oxopentanoate;hydrochloride |
| SMILES | CCCOC(=O)C(=O)CCCN.Cl |
| InChI | InChI=1S/C8H15NO3.ClH/c1-2-6-12-8(11)7(10)4-3-5-9;/h2-6,9H2,1H3;1H |
| InChIKey | XYRQFZWRSIVFTM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze propyl 5-amino-2-oxopentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 5-amino-2-oxopentanoate;hydrochloride?
The IUPAC name of propyl 5-amino-2-oxopentanoate;hydrochloride (CID 140983653) is propyl 5-amino-2-oxopentanoate;hydrochloride.
What is the SMILES notation for propyl 5-amino-2-oxopentanoate;hydrochloride?
The canonical SMILES for propyl 5-amino-2-oxopentanoate;hydrochloride is CCCOC(=O)C(=O)CCCN.Cl.
What is the InChIKey of propyl 5-amino-2-oxopentanoate;hydrochloride?
The InChIKey is XYRQFZWRSIVFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.ClH/c1-2-6-12-8(11)7(10)4-3-5-9;/h2-6,9H2,1H3;1H.
What are the key properties of propyl 5-amino-2-oxopentanoate;hydrochloride?
propyl 5-amino-2-oxopentanoate;hydrochloride has a molecular weight of 209.67 g/mol, XLogP of 0.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 5-amino-2-oxopentanoate;hydrochloride is sourced from PubChem (CID 140983653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).