About ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate
ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate (PubChem CID 140984035) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate |
| PubChem CID | 140984035 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C2Cc3ccccc3C2=O)[nH]1 |
| InChI | InChI=1S/C15H14N2O3/c1-2-20-15(19)14-16-8-12(17-14)11-7-9-5-3-4-6-10(9)13(11)18/h3-6,8,11H,2,7H2,1H3,(H,16,17) |
| InChIKey | LAVJXUVFIHSCIQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate?
The IUPAC name of ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate (CID 140984035) is ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate.
What is the SMILES notation for ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate?
The canonical SMILES for ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate is CCOC(=O)c1ncc(C2Cc3ccccc3C2=O)[nH]1.
What is the InChIKey of ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate?
The InChIKey is LAVJXUVFIHSCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c1-2-20-15(19)14-16-8-12(17-14)11-7-9-5-3-4-6-10(9)13(11)18/h3-6,8,11H,2,7H2,1H3,(H,16,17).
What are the key properties of ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate?
ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate has a molecular weight of 270.29 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3-oxo-1,2-dihydroinden-2-yl)-1H-imidazole-2-carboxylate is sourced from PubChem (CID 140984035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).