About (4-dioxidoboranylphenyl)methanol;bis(triethylazanium)
(4-dioxidoboranylphenyl)methanol;bis(triethylazanium) (PubChem CID 140984221) has the molecular formula C19H39BN2O3
and a molecular weight of 354.34 g/mol. Its IUPAC name is (4-dioxidoboranylphenyl)methanol;bis(triethylazanium).
Molecular Properties
| Compound Name | (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) |
| PubChem CID | 140984221 |
| Molecular Formula | C19H39BN2O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.[O-]B([O-])c1ccc(CO)cc1 |
| InChI | InChI=1S/C7H7BO3.2C6H15N/c9-5-6-1-3-7(4-2-6)8(10)11;2*1-4-7(5-2)6-3/h1-4,9H,5H2;2*4-6H2,1-3H3/q-2;;/p+2 |
| InChIKey | MXOUDDYYZLTAQO-UHFFFAOYSA-P |
| XLogP | -2.54 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-dioxidoboranylphenyl)methanol;bis(triethylazanium)?
The IUPAC name of (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) (CID 140984221) is (4-dioxidoboranylphenyl)methanol;bis(triethylazanium).
What is the SMILES notation for (4-dioxidoboranylphenyl)methanol;bis(triethylazanium)?
The canonical SMILES for (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) is CC[NH+](CC)CC.CC[NH+](CC)CC.[O-]B([O-])c1ccc(CO)cc1.
What is the InChIKey of (4-dioxidoboranylphenyl)methanol;bis(triethylazanium)?
The InChIKey is MXOUDDYYZLTAQO-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H7BO3.2C6H15N/c9-5-6-1-3-7(4-2-6)8(10)11;2*1-4-7(5-2)6-3/h1-4,9H,5H2;2*4-6H2,1-3H3/q-2;;/p+2.
What are the key properties of (4-dioxidoboranylphenyl)methanol;bis(triethylazanium)?
(4-dioxidoboranylphenyl)methanol;bis(triethylazanium) has a molecular weight of 354.34 g/mol, XLogP of -2.54, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dioxidoboranylphenyl)methanol;bis(triethylazanium) is sourced from PubChem (CID 140984221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).