About 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine
2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine (PubChem CID 140984508) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine |
| PubChem CID | 140984508 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine |
| SMILES | CC1=CC(N)(C(C)C)C(C)=C1C |
| InChI | InChI=1S/C11H19N/c1-7(2)11(12)6-8(3)9(4)10(11)5/h6-7H,12H2,1-5H3 |
| InChIKey | JJHMNZDZIYASFM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine?
The IUPAC name of 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine (CID 140984508) is 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine.
What is the SMILES notation for 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine?
The canonical SMILES for 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine is CC1=CC(N)(C(C)C)C(C)=C1C.
What is the InChIKey of 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine?
The InChIKey is JJHMNZDZIYASFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-7(2)11(12)6-8(3)9(4)10(11)5/h6-7H,12H2,1-5H3.
What are the key properties of 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine?
2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine has a molecular weight of 165.28 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethyl-1-propan-2-ylcyclopenta-2,4-dien-1-amine is sourced from PubChem (CID 140984508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).