C16H22ClN3O5S — CID 14098494
7-chloro-2-[2-(dimethylamino)ethyl]-4,8-dimethyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid (PubChem CID 14098494) has the molecular formula C16H22ClN3O5S and a molecular weight of 403.89 g/mol. Its IUPAC name is 7-chloro-2-[2-(dimethylamino)ethyl]-4,8-dimethyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid.
| Compound Name | 7-chloro-2-[2-(dimethylamino)ethyl]-4,8-dimethyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid |
|---|---|
| PubChem CID | 14098494 |
| Molecular Formula | C16H22ClN3O5S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 7-chloro-2-[2-(dimethylamino)ethyl]-4,8-dimethyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid |
| SMILES | Cc1nc2c(cc1Cl)C(=S)N(C)CC(CCN(C)C)O2.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20ClN3OS.C2H2O4/c1-9-12(15)7-11-13(16-9)19-10(5-6-17(2)3)8-18(4)14(11)20;3-1(4)2(5)6/h7,10H,5-6,8H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | FLDPANLSLIJDAJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|