C20H40N2O2 — CID 140984951
4-[2-(3-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-2,2,6,6-tetramethylpiperidin-3-ol (PubChem CID 140984951) has the molecular formula C20H40N2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 4-[2-(3-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-2,2,6,6-tetramethylpiperidin-3-ol.
| Compound Name | 4-[2-(3-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-2,2,6,6-tetramethylpiperidin-3-ol |
|---|---|
| PubChem CID | 140984951 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 4-[2-(3-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)ethyl]-2,2,6,6-tetramethylpiperidin-3-ol |
| SMILES | CC1(C)CC(CCC2CC(C)(C)NC(C)(C)C2O)C(O)C(C)(C)N1 |
| InChI | InChI=1S/C20H40N2O2/c1-17(2)11-13(15(23)19(5,6)21-17)9-10-14-12-18(3,4)22-20(7,8)16(14)24/h13-16,21-24H,9-12H2,1-8H3 |
| InChIKey | FFZUOEQULPZHEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |