C10H16N4O3 — CID 140985244
tert-butyl N-(4-azido-3,4-dihydro-2H-pyran-3-yl)carbamate (PubChem CID 140985244) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is tert-butyl N-(4-azido-3,4-dihydro-2H-pyran-3-yl)carbamate.
| Compound Name | tert-butyl N-(4-azido-3,4-dihydro-2H-pyran-3-yl)carbamate |
|---|---|
| PubChem CID | 140985244 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | tert-butyl N-(4-azido-3,4-dihydro-2H-pyran-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1COC=CC1N=[N+]=[N-] |
| InChI | InChI=1S/C10H16N4O3/c1-10(2,3)17-9(15)12-8-6-16-5-4-7(8)13-14-11/h4-5,7-8H,6H2,1-3H3,(H,12,15) |
| InChIKey | YRZHGSCTJNETEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|