C15H16N4O2S — CID 140985283
2-(2-hydrazinyl-4-oxo-1,3-thiazolidin-5-yl)-N-naphthalen-1-ylacetamide (PubChem CID 140985283) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-(2-hydrazinyl-4-oxo-1,3-thiazolidin-5-yl)-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(2-hydrazinyl-4-oxo-1,3-thiazolidin-5-yl)-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 140985283 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-(2-hydrazinyl-4-oxo-1,3-thiazolidin-5-yl)-N-naphthalen-1-ylacetamide |
| SMILES | NNC1NC(=O)C(CC(=O)Nc2cccc3ccccc23)S1 |
| InChI | InChI=1S/C15H16N4O2S/c16-19-15-18-14(21)12(22-15)8-13(20)17-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12,15,19H,8,16H2,(H,17,20)(H,18,21) |
| InChIKey | RFPQPZDBTHEPLY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|