C53H31N11OS — CID 140985955
1-[2-(1-benzofuran-2-yl)-1-(1-benzothiophen-2-yl)-6-(1H-indol-2-yl)-8-quinazolin-2-yl-3-(triazin-4-yl)purin-2-yl]acridine (PubChem CID 140985955) has the molecular formula C53H31N11OS and a molecular weight of 869.97 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)-1-(1-benzothiophen-2-yl)-6-(1H-indol-2-yl)-8-quinazolin-2-yl-3-(triazin-4-yl)purin-2-yl]acridine.
| Compound Name | 1-[2-(1-benzofuran-2-yl)-1-(1-benzothiophen-2-yl)-6-(1H-indol-2-yl)-8-quinazolin-2-yl-3-(triazin-4-yl)purin-2-yl]acridine |
|---|---|
| PubChem CID | 140985955 |
| Molecular Formula | C53H31N11OS |
| Molecular Weight | 869.97 g/mol |
| Exact Mass | 869.24 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)-1-(1-benzothiophen-2-yl)-6-(1H-indol-2-yl)-8-quinazolin-2-yl-3-(triazin-4-yl)purin-2-yl]acridine |
| SMILES | c1ccc2nc(C3=NC4=C(c5cc6ccccc6[nH]5)N(c5cc6ccccc6s5)C(c5cc6ccccc6o5)(c5cccc6nc7ccccc7cc56)N(c5ccnnn5)C4=N3)ncc2c1 |
| InChI | InChI=1S/C53H31N11OS/c1-6-18-38-31(12-1)26-36-37(17-11-21-41(36)56-38)53(45-28-33-14-4-9-22-43(33)65-45)63(46-24-25-55-62-61-46)52-48(59-51(60-52)50-54-30-35-16-3-8-20-40(35)58-50)49(42-27-32-13-2-7-19-39(32)57-42)64(53)47-29-34-15-5-10-23-44(34)66-47/h1-30,57H |
| InChIKey | AHNQBLQEMHKZNF-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.97 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|