C22H26F12O10 — CID 140985975
1,1,2,5,5,5-hexafluoropentyl 2-[5-[2-(1,1,2,5,5,5-hexafluoropentoxy)-2-oxoacetyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-2-oxoacetate (PubChem CID 140985975) has the molecular formula C22H26F12O10 and a molecular weight of 678.42 g/mol. Its IUPAC name is 1,1,2,5,5,5-hexafluoropentyl 2-[5-[2-(1,1,2,5,5,5-hexafluoropentoxy)-2-oxoacetyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-2-oxoacetate.
| Compound Name | 1,1,2,5,5,5-hexafluoropentyl 2-[5-[2-(1,1,2,5,5,5-hexafluoropentoxy)-2-oxoacetyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-2-oxoacetate |
|---|---|
| PubChem CID | 140985975 |
| Molecular Formula | C22H26F12O10 |
| Molecular Weight | 678.42 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | 1,1,2,5,5,5-hexafluoropentyl 2-[5-[2-(1,1,2,5,5,5-hexafluoropentoxy)-2-oxoacetyl]peroxy-2,5-dimethylhexan-2-yl]peroxy-2-oxoacetate |
| SMILES | CC(C)(CCC(C)(C)OOC(=O)C(=O)OC(F)(F)C(F)CCC(F)(F)F)OOC(=O)C(=O)OC(F)(F)C(F)CCC(F)(F)F |
| InChI | InChI=1S/C22H26F12O10/c1-17(2,43-41-15(37)13(35)39-21(31,32)11(23)5-7-19(25,26)27)9-10-18(3,4)44-42-16(38)14(36)40-22(33,34)12(24)6-8-20(28,29)30/h11-12H,5-10H2,1-4H3 |
| InChIKey | FJGPTDHIVILKEJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|