About (Z)-octadec-9-enoyl isocyanate
(Z)-octadec-9-enoyl isocyanate (PubChem CID 14098670) has the molecular formula C19H33NO2
and a molecular weight of 307.48 g/mol. Its IUPAC name is (Z)-octadec-9-enoyl isocyanate.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoyl isocyanate |
| PubChem CID | 14098670 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (Z)-octadec-9-enoyl isocyanate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N=C=O |
| InChI | InChI=1S/C19H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20-18-21/h9-10H,2-8,11-17H2,1H3/b10-9- |
| InChIKey | FQSWVADHNGQZOF-KTKRTIGZSA-N |
| XLogP | 5.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoyl isocyanate?
The IUPAC name of (Z)-octadec-9-enoyl isocyanate (CID 14098670) is (Z)-octadec-9-enoyl isocyanate.
What is the SMILES notation for (Z)-octadec-9-enoyl isocyanate?
The canonical SMILES for (Z)-octadec-9-enoyl isocyanate is CCCCCCCC/C=C\CCCCCCCC(=O)N=C=O.
What is the InChIKey of (Z)-octadec-9-enoyl isocyanate?
The InChIKey is FQSWVADHNGQZOF-KTKRTIGZSA-N. The full InChI is InChI=1S/C19H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20-18-21/h9-10H,2-8,11-17H2,1H3/b10-9-.
What are the key properties of (Z)-octadec-9-enoyl isocyanate?
(Z)-octadec-9-enoyl isocyanate has a molecular weight of 307.48 g/mol, XLogP of 5.89, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoyl isocyanate is sourced from PubChem (CID 14098670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).