About methyl indole-3a-carboxylate
methyl indole-3a-carboxylate (PubChem CID 140986853) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is methyl indole-3a-carboxylate.
Molecular Properties
| Compound Name | methyl indole-3a-carboxylate |
| PubChem CID | 140986853 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | methyl indole-3a-carboxylate |
| SMILES | COC(=O)C12C=CC=CC1=NC=C2 |
| InChI | InChI=1S/C10H9NO2/c1-13-9(12)10-5-3-2-4-8(10)11-7-6-10/h2-7H,1H3 |
| InChIKey | FBPVZUJEIVRNRE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl indole-3a-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl indole-3a-carboxylate?
The IUPAC name of methyl indole-3a-carboxylate (CID 140986853) is methyl indole-3a-carboxylate.
What is the SMILES notation for methyl indole-3a-carboxylate?
The canonical SMILES for methyl indole-3a-carboxylate is COC(=O)C12C=CC=CC1=NC=C2.
What is the InChIKey of methyl indole-3a-carboxylate?
The InChIKey is FBPVZUJEIVRNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-13-9(12)10-5-3-2-4-8(10)11-7-6-10/h2-7H,1H3.
What are the key properties of methyl indole-3a-carboxylate?
methyl indole-3a-carboxylate has a molecular weight of 175.19 g/mol, XLogP of 1.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl indole-3a-carboxylate is sourced from PubChem (CID 140986853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).