C17H27N3O — CID 140987248
cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide (PubChem CID 140987248) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140987248 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCCC1CCCCC1)[C@H]1C[C@H]1c1cnc[nH]1 |
| InChI | InChI=1S/C17H27N3O/c21-17(15-10-14(15)16-11-18-12-20-16)19-9-5-4-8-13-6-2-1-3-7-13/h11-15H,1-10H2,(H,18,20)(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | KXOVQZOTPLUFIZ-CABCVRRESA-N |
| XLogP | 3.38 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|