About cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide
cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide (PubChem CID 140987248) has the molecular formula C17H27N3O
and a molecular weight of 289.42 g/mol. Its IUPAC name is cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide |
| PubChem CID | 140987248 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCCC1CCCCC1)[C@H]1C[C@H]1c1cnc[nH]1 |
| InChI | InChI=1S/C17H27N3O/c21-17(15-10-14(15)16-11-18-12-20-16)19-9-5-4-8-13-6-2-1-3-7-13/h11-15H,1-10H2,(H,18,20)(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | KXOVQZOTPLUFIZ-CABCVRRESA-N |
| XLogP | 3.38 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide?
The IUPAC name of cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide (CID 140987248) is cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide?
The canonical SMILES for cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide is O=C(NCCCCC1CCCCC1)[C@H]1C[C@H]1c1cnc[nH]1.
What is the InChIKey of cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide?
The InChIKey is KXOVQZOTPLUFIZ-CABCVRRESA-N. The full InChI is InChI=1S/C17H27N3O/c21-17(15-10-14(15)16-11-18-12-20-16)19-9-5-4-8-13-6-2-1-3-7-13/h11-15H,1-10H2,(H,18,20)(H,19,21)/t14-,15+/m1/s1.
What are the key properties of cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide?
cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide has a molecular weight of 289.42 g/mol, XLogP of 3.38, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-N-(4-cyclohexylbutyl)-2-(1H-imidazol-5-yl)cyclopropane-1-carboxamide is sourced from PubChem (CID 140987248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).