C51H27N11O2S — CID 140988242
2-[9-(1H-benzimidazol-2-yl)-1-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-8-isoquinolin-1-yl-4-(7H-purin-2-yl)phenazin-2-yl]-1,3-benzoxazole (PubChem CID 140988242) has the molecular formula C51H27N11O2S and a molecular weight of 857.92 g/mol. Its IUPAC name is 2-[9-(1H-benzimidazol-2-yl)-1-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-8-isoquinolin-1-yl-4-(7H-purin-2-yl)phenazin-2-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-(1H-benzimidazol-2-yl)-1-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-8-isoquinolin-1-yl-4-(7H-purin-2-yl)phenazin-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 140988242 |
| Molecular Formula | C51H27N11O2S |
| Molecular Weight | 857.92 g/mol |
| Exact Mass | 857.21 |
| IUPAC Name | 2-[9-(1H-benzimidazol-2-yl)-1-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-8-isoquinolin-1-yl-4-(7H-purin-2-yl)phenazin-2-yl]-1,3-benzoxazole |
| SMILES | c1coc(-c2c(-c3nc4ccccc4o3)c(-c3nc4ccccc4s3)c3nc4c(-c5nc6ccccc6[nH]5)c(-c5nccc6ccccc56)ccc4nc3c2-c2ncc3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C51H27N11O2S/c1-2-11-27-26(10-1)21-22-52-43(27)28-19-20-33-44(38(28)49-57-29-12-3-4-13-30(29)58-49)61-46-42(51-60-32-15-6-8-18-37(32)65-51)40(50-59-31-14-5-7-16-35(31)64-50)39(36-17-9-23-63-36)41(45(46)56-33)48-53-24-34-47(62-48)55-25-54-34/h1-25H,(H,57,58)(H,53,54,55,62) |
| InChIKey | FGIOVFHNXDBDJH-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.92 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|