C16H12O — CID 140988319
tricyclo[7.5.2.02,7]hexadeca-1,3,5,7,9,11,13-heptaen-16-one (PubChem CID 140988319) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is tricyclo[7.5.2.02,7]hexadeca-1,3,5,7,9,11,13-heptaen-16-one.
| Compound Name | tricyclo[7.5.2.02,7]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
|---|---|
| PubChem CID | 140988319 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | tricyclo[7.5.2.02,7]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
| SMILES | O=C1CC2=c3ccccc3=C/C1=C/C=C\C=C\2 |
| InChI | InChI=1S/C16H12O/c17-16-11-13-6-2-1-3-8-14(16)10-12-7-4-5-9-15(12)13/h1-10H,11H2/b2-1-,3-1-,6-2+,8-3-,13-6+,14-8- |
| InChIKey | YWNYFWWJKFHOIS-RMDVMZJZSA-N |
| XLogP | 1.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |