C16H20O3 — CID 140988349
[1,1-di(cyclopenten-1-yl)-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 140988349) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [1,1-di(cyclopenten-1-yl)-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [1,1-di(cyclopenten-1-yl)-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140988349 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [1,1-di(cyclopenten-1-yl)-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C=O)(C1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C16H20O3/c1-12(2)15(18)19-16(11-17,13-7-3-4-8-13)14-9-5-6-10-14/h7,9,11H,1,3-6,8,10H2,2H3 |
| InChIKey | CXRNYAVONHWXAS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|