C22H21NO — CID 140988457
2-(cyclohepten-1-yl)-4,5-diphenyl-1,3-oxazole (PubChem CID 140988457) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(cyclohepten-1-yl)-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-(cyclohepten-1-yl)-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 140988457 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(cyclohepten-1-yl)-4,5-diphenyl-1,3-oxazole |
| SMILES | C1=C(c2nc(-c3ccccc3)c(-c3ccccc3)o2)CCCCC1 |
| InChI | InChI=1S/C22H21NO/c1-2-6-16-19(15-5-1)22-23-20(17-11-7-3-8-12-17)21(24-22)18-13-9-4-10-14-18/h3-4,7-15H,1-2,5-6,16H2 |
| InChIKey | CTQNOPYQONVKRP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |