C10H15NO3 — CID 140988554
[2-oxo-2-(2,3,4,7-tetrahydroazepin-1-yl)ethyl] acetate (PubChem CID 140988554) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,7-tetrahydroazepin-1-yl)ethyl] acetate.
| Compound Name | [2-oxo-2-(2,3,4,7-tetrahydroazepin-1-yl)ethyl] acetate |
|---|---|
| PubChem CID | 140988554 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | [2-oxo-2-(2,3,4,7-tetrahydroazepin-1-yl)ethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CC=CCCC1 |
| InChI | InChI=1S/C10H15NO3/c1-9(12)14-8-10(13)11-6-4-2-3-5-7-11/h2,4H,3,5-8H2,1H3 |
| InChIKey | RZGHFDHFZYEDLC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|