C15H20O7 — CID 140988601
5-hydroxy-4-prop-1-enylnona-2,7-diene-3,4,5-tricarboxylic acid (PubChem CID 140988601) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is 5-hydroxy-4-prop-1-enylnona-2,7-diene-3,4,5-tricarboxylic acid.
| Compound Name | 5-hydroxy-4-prop-1-enylnona-2,7-diene-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 140988601 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-hydroxy-4-prop-1-enylnona-2,7-diene-3,4,5-tricarboxylic acid |
| SMILES | CC=CC(C(=O)O)C(O)(C(=O)O)C(C=CC)(C=CC)C(=O)O |
| InChI | InChI=1S/C15H20O7/c1-4-7-10(11(16)17)15(22,13(20)21)14(8-5-2,9-6-3)12(18)19/h4-10,22H,1-3H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | KXLHGOREMJSNSN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|