C16H18BF4N — CID 140988673
3-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium tetrafluoroborate (PubChem CID 140988673) has the molecular formula C16H18BF4N and a molecular weight of 311.13 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium tetrafluoroborate.
| Compound Name | 3-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium tetrafluoroborate |
|---|---|
| PubChem CID | 140988673 |
| Molecular Formula | C16H18BF4N |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-2-ium tetrafluoroborate |
| SMILES | CC1[NH2+]Cc2ccccc2C1c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C16H17N.BF4/c1-12-16(13-7-3-2-4-8-13)15-10-6-5-9-14(15)11-17-12;2-1(3,4)5/h2-10,12,16-17H,11H2,1H3;/q;-1/p+1 |
| InChIKey | SXBNOJYCEHPXNY-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|