C6H6N4OS — CID 14098872
imidazo[2,1-b][1,3]thiazole-6-carbohydrazide (PubChem CID 14098872) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazole-6-carbohydrazide.
| Compound Name | imidazo[2,1-b][1,3]thiazole-6-carbohydrazide |
|---|---|
| PubChem CID | 14098872 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazole-6-carbohydrazide |
| SMILES | NNC(=O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C6H6N4OS/c7-9-5(11)4-3-10-1-2-12-6(10)8-4/h1-3H,7H2,(H,9,11) |
| InChIKey | YYEWLWDRYKBIKH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|