About 3-sulfonyl-4H-pyran
3-sulfonyl-4H-pyran (PubChem CID 140988757) has the molecular formula C5H6O3S
and a molecular weight of 146.17 g/mol. Its IUPAC name is 3-sulfonyl-4H-pyran.
Molecular Properties
| Compound Name | 3-sulfonyl-4H-pyran |
| PubChem CID | 140988757 |
| Molecular Formula | C5H6O3S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 3-sulfonyl-4H-pyran |
| SMILES | O=S(=O)=C1CC=COC1 |
| InChI | InChI=1S/C5H6O3S/c6-9(7)5-2-1-3-8-4-5/h1,3H,2,4H2 |
| InChIKey | SMNWPXPKJMOLKW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfonyl-4H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfonyl-4H-pyran?
The IUPAC name of 3-sulfonyl-4H-pyran (CID 140988757) is 3-sulfonyl-4H-pyran.
What is the SMILES notation for 3-sulfonyl-4H-pyran?
The canonical SMILES for 3-sulfonyl-4H-pyran is O=S(=O)=C1CC=COC1.
What is the InChIKey of 3-sulfonyl-4H-pyran?
The InChIKey is SMNWPXPKJMOLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3S/c6-9(7)5-2-1-3-8-4-5/h1,3H,2,4H2.
What are the key properties of 3-sulfonyl-4H-pyran?
3-sulfonyl-4H-pyran has a molecular weight of 146.17 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfonyl-4H-pyran is sourced from PubChem (CID 140988757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).