C12H24O2 — CID 140988786
1-butyl-1,3-dimethoxycyclohexane (PubChem CID 140988786) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-butyl-1,3-dimethoxycyclohexane.
| Compound Name | 1-butyl-1,3-dimethoxycyclohexane |
|---|---|
| PubChem CID | 140988786 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-butyl-1,3-dimethoxycyclohexane |
| SMILES | CCCCC1(OC)CCCC(OC)C1 |
| InChI | InChI=1S/C12H24O2/c1-4-5-8-12(14-3)9-6-7-11(10-12)13-2/h11H,4-10H2,1-3H3 |
| InChIKey | PCLUVMLLKNPFJJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |