About (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol
(3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol (PubChem CID 140988958) has the molecular formula C20H20F2O4S
and a molecular weight of 394.44 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol.
Molecular Properties
| Compound Name | (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol |
| PubChem CID | 140988958 |
| Molecular Formula | C20H20F2O4S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol |
| SMILES | CC1(C)OCC(C(O)c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20F2O4S/c1-20(2)18(12-4-7-14(8-5-12)27(3,24)25)15(11-26-20)19(23)13-6-9-16(21)17(22)10-13/h4-10,19,23H,11H2,1-3H3 |
| InChIKey | FUZJQLWWPRMQHI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol?
The IUPAC name of (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol (CID 140988958) is (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol.
What is the SMILES notation for (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol?
The canonical SMILES for (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol is CC1(C)OCC(C(O)c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol?
The InChIKey is FUZJQLWWPRMQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2O4S/c1-20(2)18(12-4-7-14(8-5-12)27(3,24)25)15(11-26-20)19(23)13-6-9-16(21)17(22)10-13/h4-10,19,23H,11H2,1-3H3.
What are the key properties of (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol?
(3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol has a molecular weight of 394.44 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl)-[5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-3-yl]methanol is sourced from PubChem (CID 140988958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).