C13H14F2 — CID 140989722
1-[(2,4-difluorophenyl)methyl]bicyclo[3.1.0]hexane (PubChem CID 140989722) has the molecular formula C13H14F2 and a molecular weight of 208.25 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]bicyclo[3.1.0]hexane.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 140989722 |
| Molecular Formula | C13H14F2 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]bicyclo[3.1.0]hexane |
| SMILES | Fc1ccc(CC23CCCC2C3)c(F)c1 |
| InChI | InChI=1S/C13H14F2/c14-11-4-3-9(12(15)6-11)7-13-5-1-2-10(13)8-13/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | QRLXLIIOQKHUHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |