C29H32N2O6S — CID 14098985
2-[2-[2-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]ethoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 14098985) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is 2-[2-[2-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]ethoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[2-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]ethoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 14098985 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[2-[2-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]ethoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCN(C)CCCOc2ccc3c(c2)OCO3)c(C2Sc3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C29H32N2O6S/c1-30(13-6-15-34-21-10-12-25-26(18-21)37-19-36-25)14-16-35-24-11-9-20(33-3)17-22(24)28-29(32)31(2)23-7-4-5-8-27(23)38-28/h4-5,7-12,17-18,28H,6,13-16,19H2,1-3H3 |
| InChIKey | PDKJXPGHMTUDHI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|