C30H34N2O6S — CID 14099003
2-[2-[3-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 14099003) has the molecular formula C30H34N2O6S and a molecular weight of 550.68 g/mol. Its IUPAC name is 2-[2-[3-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[3-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 14099003 |
| Molecular Formula | C30H34N2O6S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 2-[2-[3-[3-(1,3-benzodioxol-5-yloxy)propyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCN(C)CCCOc2ccc3c(c2)OCO3)c(C2Sc3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C30H34N2O6S/c1-31(14-6-16-35-22-11-13-26-27(19-22)38-20-37-26)15-7-17-36-25-12-10-21(34-3)18-23(25)29-30(33)32(2)24-8-4-5-9-28(24)39-29/h4-5,8-13,18-19,29H,6-7,14-17,20H2,1-3H3 |
| InChIKey | VMJIVJGUKYTYHU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|