C17H12FNO2S — CID 140990468
2-(2-fluorophenyl)-4,9-dihydrobenzo[f][1,3]benzothiazole-4,9-diol (PubChem CID 140990468) has the molecular formula C17H12FNO2S and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4,9-dihydrobenzo[f][1,3]benzothiazole-4,9-diol.
| Compound Name | 2-(2-fluorophenyl)-4,9-dihydrobenzo[f][1,3]benzothiazole-4,9-diol |
|---|---|
| PubChem CID | 140990468 |
| Molecular Formula | C17H12FNO2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-(2-fluorophenyl)-4,9-dihydrobenzo[f][1,3]benzothiazole-4,9-diol |
| SMILES | OC1c2ccccc2C(O)c2sc(-c3ccccc3F)nc21 |
| InChI | InChI=1S/C17H12FNO2S/c18-12-8-4-3-7-11(12)17-19-13-14(20)9-5-1-2-6-10(9)15(21)16(13)22-17/h1-8,14-15,20-21H |
| InChIKey | PMGRSYGYNQTMLE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |