C14H17F3N2O4 — CID 140992094
tert-butyl 4-nitro-2-[(2,2,2-trifluoroethylamino)methyl]benzoate (PubChem CID 140992094) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is tert-butyl 4-nitro-2-[(2,2,2-trifluoroethylamino)methyl]benzoate.
| Compound Name | tert-butyl 4-nitro-2-[(2,2,2-trifluoroethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 140992094 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | tert-butyl 4-nitro-2-[(2,2,2-trifluoroethylamino)methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc([N+](=O)[O-])cc1CNCC(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O4/c1-13(2,3)23-12(20)11-5-4-10(19(21)22)6-9(11)7-18-8-14(15,16)17/h4-6,18H,7-8H2,1-3H3 |
| InChIKey | LBWYWURXULTCJO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|