About [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane
[4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane (PubChem CID 140992356) has the molecular formula C20H46OSi4
and a molecular weight of 414.93 g/mol. Its IUPAC name is [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane |
| PubChem CID | 140992356 |
| Molecular Formula | C20H46OSi4 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(C=CCOCC=CC([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H46OSi4/c1-22(2,3)19(23(4,5)6)15-13-17-21-18-14-16-20(24(7,8)9)25(10,11)12/h13-16,19-20H,17-18H2,1-12H3 |
| InChIKey | TYAVHUWYAUWQBF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane?
The IUPAC name of [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane (CID 140992356) is [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane.
What is the SMILES notation for [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane?
The canonical SMILES for [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane is C[Si](C)(C)C(C=CCOCC=CC([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane?
The InChIKey is TYAVHUWYAUWQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H46OSi4/c1-22(2,3)19(23(4,5)6)15-13-17-21-18-14-16-20(24(7,8)9)25(10,11)12/h13-16,19-20H,17-18H2,1-12H3.
What are the key properties of [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane?
[4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane has a molecular weight of 414.93 g/mol, XLogP of 7.29, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4,4-bis(trimethylsilyl)but-2-enoxy]-1-trimethylsilylbut-2-enyl]-trimethylsilane is sourced from PubChem (CID 140992356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).