About 4-oxohexanimidamide
4-oxohexanimidamide (PubChem CID 140992385) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-oxohexanimidamide.
Molecular Properties
| Compound Name | 4-oxohexanimidamide |
| PubChem CID | 140992385 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 4-oxohexanimidamide |
| SMILES | [H]/N=C(\N)CCC(=O)CC |
| InChI | InChI=1S/C6H12N2O/c1-2-5(9)3-4-6(7)8/h2-4H2,1H3,(H3,7,8) |
| InChIKey | GZOKNKRHJJRJDG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohexanimidamide?
The IUPAC name of 4-oxohexanimidamide (CID 140992385) is 4-oxohexanimidamide.
What is the SMILES notation for 4-oxohexanimidamide?
The canonical SMILES for 4-oxohexanimidamide is [H]/N=C(\N)CCC(=O)CC.
What is the InChIKey of 4-oxohexanimidamide?
The InChIKey is GZOKNKRHJJRJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-2-5(9)3-4-6(7)8/h2-4H2,1H3,(H3,7,8).
What are the key properties of 4-oxohexanimidamide?
4-oxohexanimidamide has a molecular weight of 128.17 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohexanimidamide is sourced from PubChem (CID 140992385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).