About 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate
1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate (PubChem CID 140992613) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate |
| PubChem CID | 140992613 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate |
| SMILES | C=CN1CCCC1CC(=C=O)C(=O)OC(C)N(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-5-16-8-6-7-13(16)9-12(10-17)14(18)19-11(2)15(3)4/h5,11,13H,1,6-9H2,2-4H3 |
| InChIKey | XMUJAKLITFKNCR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate?
The IUPAC name of 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate (CID 140992613) is 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate?
The canonical SMILES for 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate is C=CN1CCCC1CC(=C=O)C(=O)OC(C)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate?
The InChIKey is XMUJAKLITFKNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-5-16-8-6-7-13(16)9-12(10-17)14(18)19-11(2)15(3)4/h5,11,13H,1,6-9H2,2-4H3.
What are the key properties of 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate?
1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate has a molecular weight of 266.34 g/mol, XLogP of 1.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-[(1-ethenylpyrrolidin-2-yl)methyl]-3-oxoprop-2-enoate is sourced from PubChem (CID 140992613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).