C23H28ClN5O2 — CID 14099295
5-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-5-azapentacyclo[6.4.0.02,10.03,7.09,11]dodecane-4,6-dione (PubChem CID 14099295) has the molecular formula C23H28ClN5O2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 5-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-5-azapentacyclo[6.4.0.02,10.03,7.09,11]dodecane-4,6-dione.
| Compound Name | 5-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-5-azapentacyclo[6.4.0.02,10.03,7.09,11]dodecane-4,6-dione |
|---|---|
| PubChem CID | 14099295 |
| Molecular Formula | C23H28ClN5O2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-5-azapentacyclo[6.4.0.02,10.03,7.09,11]dodecane-4,6-dione |
| SMILES | O=C1C2C(C(=O)N1CCCCN1CCN(c3cncc(Cl)n3)CC1)C1C3CC4C(C32)C41 |
| InChI | InChI=1S/C23H28ClN5O2/c24-14-10-25-11-15(26-14)28-7-5-27(6-8-28)3-1-2-4-29-22(30)20-18-13-9-12-16(18)17(12)19(13)21(20)23(29)31/h10-13,16-21H,1-9H2 |
| InChIKey | SQWYJCQSJDPGPD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|