About 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine
5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 140993134) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 140993134 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCCOC1=CC(N)=CC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO/c1-4-5-6-14-11-7-10(13)8-12(2,3)9-11/h7-8H,4-6,9,13H2,1-3H3 |
| InChIKey | SZESRMIEYIZCKG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine (CID 140993134) is 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine is CCCCOC1=CC(N)=CC(C)(C)C1.
What is the InChIKey of 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine?
The InChIKey is SZESRMIEYIZCKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-4-5-6-14-11-7-10(13)8-12(2,3)9-11/h7-8H,4-6,9,13H2,1-3H3.
What are the key properties of 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine?
5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine has a molecular weight of 195.31 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-3,3-dimethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 140993134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).