About propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate
propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate (PubChem CID 140993861) has the molecular formula C21H20N2O5
and a molecular weight of 380.40 g/mol. Its IUPAC name is propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate.
Molecular Properties
| Compound Name | propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate |
| PubChem CID | 140993861 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate |
| SMILES | CCCOC(=O)c1cn(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc12 |
| InChI | InChI=1S/C21H20N2O5/c1-2-9-26-21(25)15-11-23(16-6-4-3-5-14(15)16)19(20(22)24)13-7-8-17-18(10-13)28-12-27-17/h3-8,10-11,19H,2,9,12H2,1H3,(H2,22,24) |
| InChIKey | WWEGTUGCYVANIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate?
The IUPAC name of propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate (CID 140993861) is propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate.
What is the SMILES notation for propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate?
The canonical SMILES for propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate is CCCOC(=O)c1cn(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc12.
What is the InChIKey of propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate?
The InChIKey is WWEGTUGCYVANIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5/c1-2-9-26-21(25)15-11-23(16-6-4-3-5-14(15)16)19(20(22)24)13-7-8-17-18(10-13)28-12-27-17/h3-8,10-11,19H,2,9,12H2,1H3,(H2,22,24).
What are the key properties of propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate?
propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate has a molecular weight of 380.40 g/mol, XLogP of 3.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1-[2-amino-1-(1,3-benzodioxol-5-yl)-2-oxoethyl]indole-3-carboxylate is sourced from PubChem (CID 140993861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).