C15H14BF5 — CID 140994056
4-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)-4H-borinine (PubChem CID 140994056) has the molecular formula C15H14BF5 and a molecular weight of 300.08 g/mol. Its IUPAC name is 4-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)-4H-borinine.
| Compound Name | 4-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)-4H-borinine |
|---|---|
| PubChem CID | 140994056 |
| Molecular Formula | C15H14BF5 |
| Molecular Weight | 300.08 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)-4H-borinine |
| SMILES | CC(C)(C)C1C=CB(c2c(F)c(F)c(F)c(F)c2F)C=C1 |
| InChI | InChI=1S/C15H14BF5/c1-15(2,3)8-4-6-16(7-5-8)9-10(17)12(19)14(21)13(20)11(9)18/h4-8H,1-3H3 |
| InChIKey | HTOVYGSSZJGICB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.08 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|