C25H35FO3S — CID 140994257
[5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] decanoate (PubChem CID 140994257) has the molecular formula C25H35FO3S and a molecular weight of 434.62 g/mol. Its IUPAC name is [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] decanoate.
| Compound Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] decanoate |
|---|---|
| PubChem CID | 140994257 |
| Molecular Formula | C25H35FO3S |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC1CCC(C(C(=O)C2CC2)c2ccccc2F)S1 |
| InChI | InChI=1S/C25H35FO3S/c1-2-3-4-5-6-7-8-13-22(27)29-23-17-16-21(30-23)24(25(28)18-14-15-18)19-11-9-10-12-20(19)26/h9-12,18,21,23-24H,2-8,13-17H2,1H3 |
| InChIKey | DUUQVJJTXROGKE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|