C19H23FO3S — CID 140994260
[5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] butanoate (PubChem CID 140994260) has the molecular formula C19H23FO3S and a molecular weight of 350.46 g/mol. Its IUPAC name is [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] butanoate.
| Compound Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] butanoate |
|---|---|
| PubChem CID | 140994260 |
| Molecular Formula | C19H23FO3S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] butanoate |
| SMILES | CCCC(=O)OC1CCC(C(C(=O)C2CC2)c2ccccc2F)S1 |
| InChI | InChI=1S/C19H23FO3S/c1-2-5-16(21)23-17-11-10-15(24-17)18(19(22)12-8-9-12)13-6-3-4-7-14(13)20/h3-4,6-7,12,15,17-18H,2,5,8-11H2,1H3 |
| InChIKey | GHZSUASBKMJSQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |