C24H33FO3S — CID 140994262
[5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] nonanoate (PubChem CID 140994262) has the molecular formula C24H33FO3S and a molecular weight of 420.59 g/mol. Its IUPAC name is [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] nonanoate.
| Compound Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] nonanoate |
|---|---|
| PubChem CID | 140994262 |
| Molecular Formula | C24H33FO3S |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]thiolan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC1CCC(C(C(=O)C2CC2)c2ccccc2F)S1 |
| InChI | InChI=1S/C24H33FO3S/c1-2-3-4-5-6-7-12-21(26)28-22-16-15-20(29-22)23(24(27)17-13-14-17)18-10-8-9-11-19(18)25/h8-11,17,20,22-23H,2-7,12-16H2,1H3 |
| InChIKey | VLAJOFJVWBCOHY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|