About 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid
2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid (PubChem CID 140994656) has the molecular formula C21H29NO5
and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 140994656 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCC(CCC)C(=O)CN1CCC(C(=O)O)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29NO5/c1-3-5-14(6-4-2)17(23)12-22-10-9-16(21(24)25)20(22)15-7-8-18-19(11-15)27-13-26-18/h7-8,11,14,16,20H,3-6,9-10,12-13H2,1-2H3,(H,24,25) |
| InChIKey | JMMZQUMJKBIQEK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid (CID 140994656) is 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid is CCCC(CCC)C(=O)CN1CCC(C(=O)O)C1c1ccc2c(c1)OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid?
The InChIKey is JMMZQUMJKBIQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO5/c1-3-5-14(6-4-2)17(23)12-22-10-9-16(21(24)25)20(22)15-7-8-18-19(11-15)27-13-26-18/h7-8,11,14,16,20H,3-6,9-10,12-13H2,1-2H3,(H,24,25).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid?
2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid has a molecular weight of 375.47 g/mol, XLogP of 3.65, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-1-(2-oxo-3-propylhexyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 140994656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).