C17H22O2 — CID 140994722
6-ethenyl-4-ethyl-5-methyl-6-prop-2-enylnona-1,4,8-triene-3,7-dione (PubChem CID 140994722) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-ethenyl-4-ethyl-5-methyl-6-prop-2-enylnona-1,4,8-triene-3,7-dione.
| Compound Name | 6-ethenyl-4-ethyl-5-methyl-6-prop-2-enylnona-1,4,8-triene-3,7-dione |
|---|---|
| PubChem CID | 140994722 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 6-ethenyl-4-ethyl-5-methyl-6-prop-2-enylnona-1,4,8-triene-3,7-dione |
| SMILES | C=CCC(C=C)(C(=O)C=C)C(C)=C(CC)C(=O)C=C |
| InChI | InChI=1S/C17H22O2/c1-7-12-17(11-5,16(19)10-4)13(6)14(8-2)15(18)9-3/h7,9-11H,1,3-5,8,12H2,2,6H3 |
| InChIKey | DKCATDGAOWLRCM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|