About 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate
2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate (PubChem CID 14099474) has the molecular formula C16H16O4S
and a molecular weight of 304.37 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate |
| PubChem CID | 14099474 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H16O4S/c1-12-6-8-15(9-7-12)21(17,18)19-11-14-10-13-4-2-3-5-16(13)20-14/h2-9,14H,10-11H2,1H3 |
| InChIKey | JQUXYELOVDQVSW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate?
The IUPAC name of 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate (CID 14099474) is 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2Cc3ccccc3O2)cc1.
What is the InChIKey of 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate?
The InChIKey is JQUXYELOVDQVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4S/c1-12-6-8-15(9-7-12)21(17,18)19-11-14-10-13-4-2-3-5-16(13)20-14/h2-9,14H,10-11H2,1H3.
What are the key properties of 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate?
2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate has a molecular weight of 304.37 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-2-ylmethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 14099474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).