C10H13NO7 — CID 140994795
6a-amino-3,4-dihydroxy-8-(hydroxymethyl)-3,4,7,8-tetrahydrocyclopenta[b][1,4]dioxocine-2,5-dione (PubChem CID 140994795) has the molecular formula C10H13NO7 and a molecular weight of 259.21 g/mol. Its IUPAC name is 6a-amino-3,4-dihydroxy-8-(hydroxymethyl)-3,4,7,8-tetrahydrocyclopenta[b][1,4]dioxocine-2,5-dione.
| Compound Name | 6a-amino-3,4-dihydroxy-8-(hydroxymethyl)-3,4,7,8-tetrahydrocyclopenta[b][1,4]dioxocine-2,5-dione |
|---|---|
| PubChem CID | 140994795 |
| Molecular Formula | C10H13NO7 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 6a-amino-3,4-dihydroxy-8-(hydroxymethyl)-3,4,7,8-tetrahydrocyclopenta[b][1,4]dioxocine-2,5-dione |
| SMILES | NC12CC(CO)C=C1OC(=O)C(O)C(O)C(=O)O2 |
| InChI | InChI=1S/C10H13NO7/c11-10-2-4(3-12)1-5(10)17-8(15)6(13)7(14)9(16)18-10/h1,4,6-7,12-14H,2-3,11H2 |
| InChIKey | DRSOGBDQUMWZGW-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |