C10H19ClN2O3S — CID 140994862
4-methylsulfonyl-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride (PubChem CID 140994862) has the molecular formula C10H19ClN2O3S and a molecular weight of 282.79 g/mol. Its IUPAC name is 4-methylsulfonyl-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride.
| Compound Name | 4-methylsulfonyl-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
|---|---|
| PubChem CID | 140994862 |
| Molecular Formula | C10H19ClN2O3S |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-methylsulfonyl-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
| SMILES | CCCC1C(=O)N(S(C)(=O)=O)C2CCNC12.Cl |
| InChI | InChI=1S/C10H18N2O3S.ClH/c1-3-4-7-9-8(5-6-11-9)12(10(7)13)16(2,14)15;/h7-9,11H,3-6H2,1-2H3;1H |
| InChIKey | JLMNOUMIDRZQFN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |