C11H16Cl2N4O3S — CID 14099550
3-[(2,2-dichlorocyclopropyl)methylsulfonyl]-N,N-diethyl-1,2,4-triazole-1-carboxamide (PubChem CID 14099550) has the molecular formula C11H16Cl2N4O3S and a molecular weight of 355.25 g/mol. Its IUPAC name is 3-[(2,2-dichlorocyclopropyl)methylsulfonyl]-N,N-diethyl-1,2,4-triazole-1-carboxamide.
| Compound Name | 3-[(2,2-dichlorocyclopropyl)methylsulfonyl]-N,N-diethyl-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 14099550 |
| Molecular Formula | C11H16Cl2N4O3S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3-[(2,2-dichlorocyclopropyl)methylsulfonyl]-N,N-diethyl-1,2,4-triazole-1-carboxamide |
| SMILES | CCN(CC)C(=O)n1cnc(S(=O)(=O)CC2CC2(Cl)Cl)n1 |
| InChI | InChI=1S/C11H16Cl2N4O3S/c1-3-16(4-2)10(18)17-7-14-9(15-17)21(19,20)6-8-5-11(8,12)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | AFRGHSJLBLZBRW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|