About 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride
1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride (PubChem CID 140995624) has the molecular formula C13H14Cl3NO
and a molecular weight of 306.62 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride.
Molecular Properties
| Compound Name | 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride |
| PubChem CID | 140995624 |
| Molecular Formula | C13H14Cl3NO |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC(=O)c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C13H11NO.3ClH/c14-13(15)11-6-9-3-1-2-8-4-5-10(7-11)12(8)9;;;/h1-3,6-7H,4-5H2,(H2,14,15);3*1H |
| InChIKey | LTDQMNVBYNSGOE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride?
The IUPAC name of 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride (CID 140995624) is 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride.
What is the SMILES notation for 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride?
The canonical SMILES for 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride is Cl.Cl.Cl.NC(=O)c1cc2c3c(cccc3c1)CC2.
What is the InChIKey of 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride?
The InChIKey is LTDQMNVBYNSGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.3ClH/c14-13(15)11-6-9-3-1-2-8-4-5-10(7-11)12(8)9;;;/h1-3,6-7H,4-5H2,(H2,14,15);3*1H.
What are the key properties of 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride?
1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride has a molecular weight of 306.62 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroacenaphthylene-4-carboxamide;trihydrochloride is sourced from PubChem (CID 140995624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).