About 6-ethynyl-7-methyldodeca-4,8-diyne
6-ethynyl-7-methyldodeca-4,8-diyne (PubChem CID 140995682) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-ethynyl-7-methyldodeca-4,8-diyne.
Molecular Properties
| Compound Name | 6-ethynyl-7-methyldodeca-4,8-diyne |
| PubChem CID | 140995682 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 6-ethynyl-7-methyldodeca-4,8-diyne |
| SMILES | C#CC(C#CCCC)C(C)C#CCCC |
| InChI | InChI=1S/C15H20/c1-5-8-10-12-14(4)15(7-3)13-11-9-6-2/h3,14-15H,5-6,8-9H2,1-2,4H3 |
| InChIKey | JKSJSIZBYGNOKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-7-methyldodeca-4,8-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-7-methyldodeca-4,8-diyne?
The IUPAC name of 6-ethynyl-7-methyldodeca-4,8-diyne (CID 140995682) is 6-ethynyl-7-methyldodeca-4,8-diyne.
What is the SMILES notation for 6-ethynyl-7-methyldodeca-4,8-diyne?
The canonical SMILES for 6-ethynyl-7-methyldodeca-4,8-diyne is C#CC(C#CCCC)C(C)C#CCCC.
What is the InChIKey of 6-ethynyl-7-methyldodeca-4,8-diyne?
The InChIKey is JKSJSIZBYGNOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-5-8-10-12-14(4)15(7-3)13-11-9-6-2/h3,14-15H,5-6,8-9H2,1-2,4H3.
What are the key properties of 6-ethynyl-7-methyldodeca-4,8-diyne?
6-ethynyl-7-methyldodeca-4,8-diyne has a molecular weight of 200.32 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-7-methyldodeca-4,8-diyne is sourced from PubChem (CID 140995682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).