About bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane
bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane (PubChem CID 140995830) has the molecular formula C30H39BO2
and a molecular weight of 442.45 g/mol. Its IUPAC name is bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane.
Molecular Properties
| Compound Name | bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane |
| PubChem CID | 140995830 |
| Molecular Formula | C30H39BO2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane |
| SMILES | CCc1ccc(OB(Oc2ccc(CC)c(CC)c2)c2ccc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C30H39BO2/c1-7-22-13-16-28(19-25(22)10-4)31(32-29-17-14-23(8-2)26(11-5)20-29)33-30-18-15-24(9-3)27(12-6)21-30/h13-21H,7-12H2,1-6H3 |
| InChIKey | DTZCDBUIDQCGBQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane?
The IUPAC name of bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane (CID 140995830) is bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane.
What is the SMILES notation for bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane?
The canonical SMILES for bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane is CCc1ccc(OB(Oc2ccc(CC)c(CC)c2)c2ccc(CC)c(CC)c2)cc1CC.
What is the InChIKey of bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane?
The InChIKey is DTZCDBUIDQCGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H39BO2/c1-7-22-13-16-28(19-25(22)10-4)31(32-29-17-14-23(8-2)26(11-5)20-29)33-30-18-15-24(9-3)27(12-6)21-30/h13-21H,7-12H2,1-6H3.
What are the key properties of bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane?
bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane has a molecular weight of 442.45 g/mol, XLogP of 6.91, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,4-diethylphenoxy)-(3,4-diethylphenyl)borane is sourced from PubChem (CID 140995830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).