C12H3Cl8N — CID 140995963
2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)aniline (PubChem CID 140995963) has the molecular formula C12H3Cl8N and a molecular weight of 444.79 g/mol. Its IUPAC name is 2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)aniline.
| Compound Name | 2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)aniline |
|---|---|
| PubChem CID | 140995963 |
| Molecular Formula | C12H3Cl8N |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 440.78 |
| IUPAC Name | 2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)aniline |
| SMILES | Nc1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl8N/c13-5-2(1-3(21)6(14)9(5)17)4-7(15)10(18)12(20)11(19)8(4)16/h1H,21H2 |
| InChIKey | FQAYUBFWLITUSA-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|