About 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine
3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine (PubChem CID 140996382) has the molecular formula C11H8Cl3FN2S
and a molecular weight of 325.62 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine |
| PubChem CID | 140996382 |
| Molecular Formula | C11H8Cl3FN2S |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine |
| SMILES | [H]/N=c1\sc(C)cn1-c1ccc(F)c(C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C11H8Cl3FN2S/c1-6-5-17(10(16)18-6)7-2-3-9(15)8(4-7)11(12,13)14/h2-5,16H,1H3/b16-10- |
| InChIKey | PZJLYIPLNXIUPO-YBEGLDIGSA-N |
| XLogP | 4.29 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine?
The IUPAC name of 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine (CID 140996382) is 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine.
What is the SMILES notation for 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine?
The canonical SMILES for 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine is [H]/N=c1\sc(C)cn1-c1ccc(F)c(C(Cl)(Cl)Cl)c1.
What is the InChIKey of 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine?
The InChIKey is PZJLYIPLNXIUPO-YBEGLDIGSA-N. The full InChI is InChI=1S/C11H8Cl3FN2S/c1-6-5-17(10(16)18-6)7-2-3-9(15)8(4-7)11(12,13)14/h2-5,16H,1H3/b16-10-.
What are the key properties of 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine?
3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine has a molecular weight of 325.62 g/mol, XLogP of 4.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-fluoro-3-(trichloromethyl)phenyl]-5-methyl-1,3-thiazol-2-imine is sourced from PubChem (CID 140996382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).